C15H8Cl2F5NO2 — CID 4249290
2-(2,4-dichlorophenoxy)-N-(2,3,4,5,6-pentafluorophenyl)propanamide (PubChem CID 4249290) has the molecular formula C15H8Cl2F5NO2 and a molecular weight of 400.13 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N-(2,3,4,5,6-pentafluorophenyl)propanamide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
|---|---|
| PubChem CID | 4249290 |
| Molecular Formula | C15H8Cl2F5NO2 |
| Molecular Weight | 400.13 g/mol |
| Exact Mass | 398.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N-(2,3,4,5,6-pentafluorophenyl)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C15H8Cl2F5NO2/c1-5(25-8-3-2-6(16)4-7(8)17)15(24)23-14-12(21)10(19)9(18)11(20)13(14)22/h2-5H,1H3,(H,23,24) |
| InChIKey | CZDAVDVPNKNADL-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.13 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|