C18H17Cl2FN2O4 — CID 43004127
N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 43004127) has the molecular formula C18H17Cl2FN2O4 and a molecular weight of 415.25 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 43004127 |
| Molecular Formula | C18H17Cl2FN2O4 |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 414.05 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)C(C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H17Cl2FN2O4/c1-10(26-14-6-4-13(21)5-7-14)17(24)22-23-18(25)11(2)27-16-8-3-12(19)9-15(16)20/h3-11H,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | SMUHEWSBRYHZRV-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|