C15H13Cl2FN2O2 — CID 118727201
2-(2,4-dichlorophenoxy)-N'-(4-fluorophenyl)propanehydrazide (PubChem CID 118727201) has the molecular formula C15H13Cl2FN2O2 and a molecular weight of 343.19 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-(4-fluorophenyl)propanehydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-(4-fluorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 118727201 |
| Molecular Formula | C15H13Cl2FN2O2 |
| Molecular Weight | 343.19 g/mol |
| Exact Mass | 342.03 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-(4-fluorophenyl)propanehydrazide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNc1ccc(F)cc1 |
| InChI | InChI=1S/C15H13Cl2FN2O2/c1-9(22-14-7-2-10(16)8-13(14)17)15(21)20-19-12-5-3-11(18)4-6-12/h2-9,19H,1H3,(H,20,21) |
| InChIKey | YGCWOBJEJBLWGB-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.19 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|