C11H9Cl2F3N2O3 — CID 3349726
2-(2,4-dichlorophenoxy)-N'-(2,2,2-trifluoroacetyl)propanehydrazide (PubChem CID 3349726) has the molecular formula C11H9Cl2F3N2O3 and a molecular weight of 345.10 g/mol. Its IUPAC name is 2-(2,4-dichlorophenoxy)-N'-(2,2,2-trifluoroacetyl)propanehydrazide.
| Compound Name | 2-(2,4-dichlorophenoxy)-N'-(2,2,2-trifluoroacetyl)propanehydrazide |
|---|---|
| PubChem CID | 3349726 |
| Molecular Formula | C11H9Cl2F3N2O3 |
| Molecular Weight | 345.10 g/mol |
| Exact Mass | 343.99 |
| IUPAC Name | 2-(2,4-dichlorophenoxy)-N'-(2,2,2-trifluoroacetyl)propanehydrazide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H9Cl2F3N2O3/c1-5(9(19)17-18-10(20)11(14,15)16)21-8-3-2-6(12)4-7(8)13/h2-5H,1H3,(H,17,19)(H,18,20) |
| InChIKey | SPWSTROXJRGEOP-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|