C14H18Cl2N2O4 — CID 51573379
tert-butyl N-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamate (PubChem CID 51573379) has the molecular formula C14H18Cl2N2O4 and a molecular weight of 349.21 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamate |
|---|---|
| PubChem CID | 51573379 |
| Molecular Formula | C14H18Cl2N2O4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | tert-butyl N-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamate |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H18Cl2N2O4/c1-8(21-11-6-5-9(15)7-10(11)16)12(19)17-18-13(20)22-14(2,3)4/h5-8H,1-4H3,(H,17,19)(H,18,20)/t8-/m0/s1 |
| InChIKey | PDPJSYLFFRSPNH-QMMMGPOBSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|