C11H13Cl2N3O2S — CID 40640579
1-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-methylthiourea (PubChem CID 40640579) has the molecular formula C11H13Cl2N3O2S and a molecular weight of 322.22 g/mol. Its IUPAC name is 1-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-methylthiourea.
| Compound Name | 1-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-methylthiourea |
|---|---|
| PubChem CID | 40640579 |
| Molecular Formula | C11H13Cl2N3O2S |
| Molecular Weight | 322.22 g/mol |
| Exact Mass | 321.01 |
| IUPAC Name | 1-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-3-methylthiourea |
| SMILES | CNC(=S)NNC(=O)[C@H](C)Oc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H13Cl2N3O2S/c1-6(10(17)15-16-11(19)14-2)18-9-4-3-7(12)5-8(9)13/h3-6H,1-2H3,(H,15,17)(H2,14,16,19)/t6-/m0/s1 |
| InChIKey | SQALJBGQYIISHX-LURJTMIESA-N |
| XLogP | 1.89 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|