C17H13Cl4N3O3S — CID 4500273
N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4500273) has the molecular formula C17H13Cl4N3O3S and a molecular weight of 481.19 g/mol. Its IUPAC name is N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4500273 |
| Molecular Formula | C17H13Cl4N3O3S |
| Molecular Weight | 481.19 g/mol |
| Exact Mass | 478.94 |
| IUPAC Name | N-[[(2,4-dichlorobenzoyl)amino]carbamothioyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NC(=S)NNC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H13Cl4N3O3S/c1-8(27-14-5-3-10(19)7-13(14)21)15(25)22-17(28)24-23-16(26)11-4-2-9(18)6-12(11)20/h2-8H,1H3,(H,23,26)(H2,22,24,25,28) |
| InChIKey | IDONAOPKEVQUPK-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.19 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|