C17H14Cl2N2O5 — CID 3349728
2-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamoyl]benzoic acid (PubChem CID 3349728) has the molecular formula C17H14Cl2N2O5 and a molecular weight of 397.21 g/mol. Its IUPAC name is 2-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamoyl]benzoic acid.
| Compound Name | 2-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 3349728 |
| Molecular Formula | C17H14Cl2N2O5 |
| Molecular Weight | 397.21 g/mol |
| Exact Mass | 396.03 |
| IUPAC Name | 2-[[2-(2,4-dichlorophenoxy)propanoylamino]carbamoyl]benzoic acid |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1ccccc1C(=O)O |
| InChI | InChI=1S/C17H14Cl2N2O5/c1-9(26-14-7-6-10(18)8-13(14)19)15(22)20-21-16(23)11-4-2-3-5-12(11)17(24)25/h2-9H,1H3,(H,20,22)(H,21,23)(H,24,25) |
| InChIKey | VVPRKMRVRPVCGC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.21 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|