C23H19Cl2N3O4 — CID 2210922
N-[4-[[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamoyl]phenyl]benzamide (PubChem CID 2210922) has the molecular formula C23H19Cl2N3O4 and a molecular weight of 472.33 g/mol. Its IUPAC name is N-[4-[[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamoyl]phenyl]benzamide.
| Compound Name | N-[4-[[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2210922 |
| Molecular Formula | C23H19Cl2N3O4 |
| Molecular Weight | 472.33 g/mol |
| Exact Mass | 471.08 |
| IUPAC Name | N-[4-[[[(2R)-2-(2,4-dichlorophenoxy)propanoyl]amino]carbamoyl]phenyl]benzamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1ccc(NC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19Cl2N3O4/c1-14(32-20-12-9-17(24)13-19(20)25)21(29)27-28-23(31)16-7-10-18(11-8-16)26-22(30)15-5-3-2-4-6-15/h2-14H,1H3,(H,26,30)(H,27,29)(H,28,31)/t14-/m1/s1 |
| InChIKey | JBIOMUUKQOYNBA-CQSZACIVSA-N |
| XLogP | 4.47 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|