C24H22Cl2N2O5 — CID 4955112
N'-[2-(2,4-dichlorophenoxy)propanoyl]-3-(2-phenoxyethoxy)benzohydrazide (PubChem CID 4955112) has the molecular formula C24H22Cl2N2O5 and a molecular weight of 489.36 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenoxy)propanoyl]-3-(2-phenoxyethoxy)benzohydrazide.
| Compound Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-3-(2-phenoxyethoxy)benzohydrazide |
|---|---|
| PubChem CID | 4955112 |
| Molecular Formula | C24H22Cl2N2O5 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | N'-[2-(2,4-dichlorophenoxy)propanoyl]-3-(2-phenoxyethoxy)benzohydrazide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C24H22Cl2N2O5/c1-16(33-22-11-10-18(25)15-21(22)26)23(29)27-28-24(30)17-6-5-9-20(14-17)32-13-12-31-19-7-3-2-4-8-19/h2-11,14-16H,12-13H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | KMCBSQRAFWPBHD-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|