C17H15Cl2N3O4 — CID 17078734
2-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-2-oxo-N-phenylacetamide (PubChem CID 17078734) has the molecular formula C17H15Cl2N3O4 and a molecular weight of 396.23 g/mol. Its IUPAC name is 2-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-2-oxo-N-phenylacetamide.
| Compound Name | 2-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-2-oxo-N-phenylacetamide |
|---|---|
| PubChem CID | 17078734 |
| Molecular Formula | C17H15Cl2N3O4 |
| Molecular Weight | 396.23 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | 2-[2-[2-(2,4-dichlorophenoxy)propanoyl]hydrazinyl]-2-oxo-N-phenylacetamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)NNC(=O)C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H15Cl2N3O4/c1-10(26-14-8-7-11(18)9-13(14)19)15(23)21-22-17(25)16(24)20-12-5-3-2-4-6-12/h2-10H,1H3,(H,20,24)(H,21,23)(H,22,25) |
| InChIKey | DHIUKBBMUFQBBO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.23 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|