C15H10Cl2N2O4 — CID 1010177
2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]benzoic acid (PubChem CID 1010177) has the molecular formula C15H10Cl2N2O4 and a molecular weight of 353.16 g/mol. Its IUPAC name is 2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]benzoic acid.
| Compound Name | 2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 1010177 |
| Molecular Formula | C15H10Cl2N2O4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | 2-[[(2,4-dichlorobenzoyl)amino]carbamoyl]benzoic acid |
| SMILES | O=C(NNC(=O)c1ccccc1C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H10Cl2N2O4/c16-8-5-6-11(12(17)7-8)14(21)19-18-13(20)9-3-1-2-4-10(9)15(22)23/h1-7H,(H,18,20)(H,19,21)(H,22,23) |
| InChIKey | VVCQVBJSIZTRAE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|