C26H17Cl2NO3 — CID 10183146
2-[(2,4-dichlorobenzoyl)amino]-5-(3-phenylphenyl)benzoic acid (PubChem CID 10183146) has the molecular formula C26H17Cl2NO3 and a molecular weight of 462.33 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-(3-phenylphenyl)benzoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(3-phenylphenyl)benzoic acid |
|---|---|
| PubChem CID | 10183146 |
| Molecular Formula | C26H17Cl2NO3 |
| Molecular Weight | 462.33 g/mol |
| Exact Mass | 461.06 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(3-phenylphenyl)benzoic acid |
| SMILES | O=C(Nc1ccc(-c2cccc(-c3ccccc3)c2)cc1C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H17Cl2NO3/c27-20-10-11-21(23(28)15-20)25(30)29-24-12-9-19(14-22(24)26(31)32)18-8-4-7-17(13-18)16-5-2-1-3-6-16/h1-15H,(H,29,30)(H,31,32) |
| InChIKey | USYQQLCYVKXVOD-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.33 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |