C15H11Cl2NO3 — CID 4287647
2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid (PubChem CID 4287647) has the molecular formula C15H11Cl2NO3 and a molecular weight of 324.16 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid |
|---|---|
| PubChem CID | 4287647 |
| Molecular Formula | C15H11Cl2NO3 |
| Molecular Weight | 324.16 g/mol |
| Exact Mass | 323.01 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-methylbenzoic acid |
| SMILES | Cc1ccc(NC(=O)c2ccc(Cl)cc2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C15H11Cl2NO3/c1-8-2-5-13(11(6-8)15(20)21)18-14(19)10-4-3-9(16)7-12(10)17/h2-7H,1H3,(H,18,19)(H,20,21) |
| InChIKey | BXQIAYMIOWYCGX-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.16 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |