C14H11Cl2NO2 — CID 63528661
2-(2,5-dichloroanilino)-5-methylbenzoic acid (PubChem CID 63528661) has the molecular formula C14H11Cl2NO2 and a molecular weight of 296.15 g/mol. Its IUPAC name is 2-(2,5-dichloroanilino)-5-methylbenzoic acid.
| Compound Name | 2-(2,5-dichloroanilino)-5-methylbenzoic acid |
|---|---|
| PubChem CID | 63528661 |
| Molecular Formula | C14H11Cl2NO2 |
| Molecular Weight | 296.15 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-(2,5-dichloroanilino)-5-methylbenzoic acid |
| SMILES | Cc1ccc(Nc2cc(Cl)ccc2Cl)c(C(=O)O)c1 |
| InChI | InChI=1S/C14H11Cl2NO2/c1-8-2-5-12(10(6-8)14(18)19)17-13-7-9(15)3-4-11(13)16/h2-7,17H,1H3,(H,18,19) |
| InChIKey | NMDFSUDZIOSALE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.15 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |