C23H19Cl2NO4 — CID 10138370
2-[(2,4-dichlorobenzoyl)amino]-5-[2-(3-methylphenyl)ethoxy]benzoic acid (PubChem CID 10138370) has the molecular formula C23H19Cl2NO4 and a molecular weight of 444.31 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-[2-(3-methylphenyl)ethoxy]benzoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-[2-(3-methylphenyl)ethoxy]benzoic acid |
|---|---|
| PubChem CID | 10138370 |
| Molecular Formula | C23H19Cl2NO4 |
| Molecular Weight | 444.31 g/mol |
| Exact Mass | 443.07 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-[2-(3-methylphenyl)ethoxy]benzoic acid |
| SMILES | Cc1cccc(CCOc2ccc(NC(=O)c3ccc(Cl)cc3Cl)c(C(=O)O)c2)c1 |
| InChI | InChI=1S/C23H19Cl2NO4/c1-14-3-2-4-15(11-14)9-10-30-17-6-8-21(19(13-17)23(28)29)26-22(27)18-7-5-16(24)12-20(18)25/h2-8,11-13H,9-10H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | SOJZZQJHBVTNPN-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.31 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |