C18H12Cl2LiN3O4 — CID 173234722
lithium;2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid;hydride (PubChem CID 173234722) has the molecular formula C18H12Cl2LiN3O4 and a molecular weight of 412.16 g/mol. Its IUPAC name is lithium;2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid;hydride.
| Compound Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid;hydride |
|---|---|
| PubChem CID | 173234722 |
| Molecular Formula | C18H12Cl2LiN3O4 |
| Molecular Weight | 412.16 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-pyrimidin-2-yloxybenzoic acid;hydride |
| SMILES | O=C(Nc1ccc(Oc2ncccn2)cc1C(=O)O)c1ccc(Cl)cc1Cl.[H-].[Li+] |
| InChI | InChI=1S/C18H11Cl2N3O4.Li.H/c19-10-2-4-12(14(20)8-10)16(24)23-15-5-3-11(9-13(15)17(25)26)27-18-21-6-1-7-22-18;;/h1-9H,(H,23,24)(H,25,26);;/q;+1;-1 |
| InChIKey | SEXYJTCRYSDFCM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 101.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.16 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |