C26H17Cl2NO4 — CID 10227538
2-[(2,4-dichlorobenzoyl)amino]-5-(4-phenoxyphenyl)benzoic acid (PubChem CID 10227538) has the molecular formula C26H17Cl2NO4 and a molecular weight of 478.33 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-(4-phenoxyphenyl)benzoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(4-phenoxyphenyl)benzoic acid |
|---|---|
| PubChem CID | 10227538 |
| Molecular Formula | C26H17Cl2NO4 |
| Molecular Weight | 478.33 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(4-phenoxyphenyl)benzoic acid |
| SMILES | O=C(Nc1ccc(-c2ccc(Oc3ccccc3)cc2)cc1C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C26H17Cl2NO4/c27-18-9-12-21(23(28)15-18)25(30)29-24-13-8-17(14-22(24)26(31)32)16-6-10-20(11-7-16)33-19-4-2-1-3-5-19/h1-15H,(H,29,30)(H,31,32) |
| InChIKey | GSNSYYWZOXLIGD-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.33 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |