2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid

C18H11Cl2NO4 — CID 10270857

IUPAC2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid
SMILESO=C(Nc1ccc(-c2ccco2)cc1C(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C18H11Cl2NO4/c19-11-4-5-12(14(20)9-11)17(22)21-15-6-3-10(8-13(15)18(23)24)16-2-1-7-25-16/h1-9H,(H,21,22)(H,23,24)
InChIKeyIVQFOWVLYRHJKW-UHFFFAOYSA-N
MW376.20 g/mol
LogP5.20
Rot. Bonds4

About 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid

2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid (PubChem CID 10270857) has the molecular formula C18H11Cl2NO4 and a molecular weight of 376.20 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid.

Molecular Properties

Compound Name2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid
PubChem CID10270857
Molecular FormulaC18H11Cl2NO4
Molecular Weight376.20 g/mol
Exact Mass375.01
IUPAC Name2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid
SMILESO=C(Nc1ccc(-c2ccco2)cc1C(=O)O)c1ccc(Cl)cc1Cl
InChIInChI=1S/C18H11Cl2NO4/c19-11-4-5-12(14(20)9-11)17(22)21-15-6-3-10(8-13(15)18(23)24)16-2-1-7-25-16/h1-9H,(H,21,22)(H,23,24)
InChIKeyIVQFOWVLYRHJKW-UHFFFAOYSA-N
XLogP5.20
TPSA79.54 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500376.20
LogP ≤ 55.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid?
The IUPAC name of 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid (CID 10270857) is 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid.
What is the SMILES notation for 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid?
The canonical SMILES for 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid is O=C(Nc1ccc(-c2ccco2)cc1C(=O)O)c1ccc(Cl)cc1Cl.
What is the InChIKey of 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid?
The InChIKey is IVQFOWVLYRHJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11Cl2NO4/c19-11-4-5-12(14(20)9-11)17(22)21-15-6-3-10(8-13(15)18(23)24)16-2-1-7-25-16/h1-9H,(H,21,22)(H,23,24).
What are the key properties of 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid?
2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid has a molecular weight of 376.20 g/mol, XLogP of 5.20, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid is sourced from PubChem (CID 10270857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).