C18H11Cl2NO4 — CID 10270857
2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid (PubChem CID 10270857) has the molecular formula C18H11Cl2NO4 and a molecular weight of 376.20 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 10270857 |
| Molecular Formula | C18H11Cl2NO4 |
| Molecular Weight | 376.20 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-(furan-2-yl)benzoic acid |
| SMILES | O=C(Nc1ccc(-c2ccco2)cc1C(=O)O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C18H11Cl2NO4/c19-11-4-5-12(14(20)9-11)17(22)21-15-6-3-10(8-13(15)18(23)24)16-2-1-7-25-16/h1-9H,(H,21,22)(H,23,24) |
| InChIKey | IVQFOWVLYRHJKW-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.20 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |