C17H11Cl2NO2 — CID 168526277
2,4-dichloro-N-[3-(furan-2-yl)phenyl]benzamide (PubChem CID 168526277) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 2,4-dichloro-N-[3-(furan-2-yl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[3-(furan-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 168526277 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 2,4-dichloro-N-[3-(furan-2-yl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(-c2ccco2)c1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2NO2/c18-12-6-7-14(15(19)10-12)17(21)20-13-4-1-3-11(9-13)16-5-2-8-22-16/h1-10H,(H,20,21) |
| InChIKey | WDXGEQZOOCVCEG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |