C20H15Cl2NO3 — CID 142203101
2,4-dichloro-N-[4-(furan-2-yl)-2-propanoylphenyl]benzamide (PubChem CID 142203101) has the molecular formula C20H15Cl2NO3 and a molecular weight of 388.25 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(furan-2-yl)-2-propanoylphenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(furan-2-yl)-2-propanoylphenyl]benzamide |
|---|---|
| PubChem CID | 142203101 |
| Molecular Formula | C20H15Cl2NO3 |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 2,4-dichloro-N-[4-(furan-2-yl)-2-propanoylphenyl]benzamide |
| SMILES | CCC(=O)c1cc(-c2ccco2)ccc1NC(=O)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl2NO3/c1-2-18(24)15-10-12(19-4-3-9-26-19)5-8-17(15)23-20(25)14-7-6-13(21)11-16(14)22/h3-11H,2H2,1H3,(H,23,25) |
| InChIKey | BZOQHYWHCWZVSG-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |