C20H12Cl2NO3- — CID 59060344
2-[(2,4-dichlorobenzoyl)amino]-5-phenylbenzoate (PubChem CID 59060344) has the molecular formula C20H12Cl2NO3- and a molecular weight of 385.23 g/mol. Its IUPAC name is 2-[(2,4-dichlorobenzoyl)amino]-5-phenylbenzoate.
| Compound Name | 2-[(2,4-dichlorobenzoyl)amino]-5-phenylbenzoate |
|---|---|
| PubChem CID | 59060344 |
| Molecular Formula | C20H12Cl2NO3- |
| Molecular Weight | 385.23 g/mol |
| Exact Mass | 384.02 |
| IUPAC Name | 2-[(2,4-dichlorobenzoyl)amino]-5-phenylbenzoate |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1C(=O)[O-])c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C20H13Cl2NO3/c21-14-7-8-15(17(22)11-14)19(24)23-18-9-6-13(10-16(18)20(25)26)12-4-2-1-3-5-12/h1-11H,(H,23,24)(H,25,26)/p-1 |
| InChIKey | MHXSUKGJJRRCLH-UHFFFAOYSA-M |
| XLogP | 4.28 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.23 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |