C23H16Cl2LiNO3S — CID 161123218
lithium;5-(1-benzothiophen-3-yl)-2-[(2,4-dichlorobenzoyl)amino]benzoate;methane (PubChem CID 161123218) has the molecular formula C23H16Cl2LiNO3S and a molecular weight of 464.30 g/mol. Its IUPAC name is lithium;5-(1-benzothiophen-3-yl)-2-[(2,4-dichlorobenzoyl)amino]benzoate;methane.
| Compound Name | lithium;5-(1-benzothiophen-3-yl)-2-[(2,4-dichlorobenzoyl)amino]benzoate;methane |
|---|---|
| PubChem CID | 161123218 |
| Molecular Formula | C23H16Cl2LiNO3S |
| Molecular Weight | 464.30 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | lithium;5-(1-benzothiophen-3-yl)-2-[(2,4-dichlorobenzoyl)amino]benzoate;methane |
| SMILES | C.O=C(Nc1ccc(-c2csc3ccccc23)cc1C(=O)[O-])c1ccc(Cl)cc1Cl.[Li+] |
| InChI | InChI=1S/C22H13Cl2NO3S.CH4.Li/c23-13-6-7-15(18(24)10-13)21(26)25-19-8-5-12(9-16(19)22(27)28)17-11-29-20-4-2-1-3-14(17)20;;/h1-11H,(H,25,26)(H,27,28);1H4;/q;;+1/p-1 |
| InChIKey | RAJGQGLPNUSGLJ-UHFFFAOYSA-M |
| XLogP | 3.13 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |