C23H20Cl2LiNO6 — CID 159142897
lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[2-(2-methoxyphenoxy)ethoxy]benzoate;molecular hydrogen (PubChem CID 159142897) has the molecular formula C23H20Cl2LiNO6 and a molecular weight of 484.26 g/mol. Its IUPAC name is lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[2-(2-methoxyphenoxy)ethoxy]benzoate;molecular hydrogen.
| Compound Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[2-(2-methoxyphenoxy)ethoxy]benzoate;molecular hydrogen |
|---|---|
| PubChem CID | 159142897 |
| Molecular Formula | C23H20Cl2LiNO6 |
| Molecular Weight | 484.26 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | lithium;2-[(2,4-dichlorobenzoyl)amino]-5-[2-(2-methoxyphenoxy)ethoxy]benzoate;molecular hydrogen |
| SMILES | COc1ccccc1OCCOc1ccc(NC(=O)c2ccc(Cl)cc2Cl)c(C(=O)[O-])c1.[H][H].[Li+] |
| InChI | InChI=1S/C23H19Cl2NO6.Li.H2/c1-30-20-4-2-3-5-21(20)32-11-10-31-15-7-9-19(17(13-15)23(28)29)26-22(27)16-8-6-14(24)12-18(16)25;;/h2-9,12-13H,10-11H2,1H3,(H,26,27)(H,28,29);;1H/q;+1;/p-1 |
| InChIKey | VBFDGAFYHUJGGL-UHFFFAOYSA-M |
| XLogP | 1.33 |
| TPSA | 96.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|