C20H14ClNO4 — CID 46853577
2-[(4-chloro-2-hydroxybenzoyl)amino]-4-phenylbenzoic acid (PubChem CID 46853577) has the molecular formula C20H14ClNO4 and a molecular weight of 367.79 g/mol. Its IUPAC name is 2-[(4-chloro-2-hydroxybenzoyl)amino]-4-phenylbenzoic acid.
| Compound Name | 2-[(4-chloro-2-hydroxybenzoyl)amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 46853577 |
| Molecular Formula | C20H14ClNO4 |
| Molecular Weight | 367.79 g/mol |
| Exact Mass | 367.06 |
| IUPAC Name | 2-[(4-chloro-2-hydroxybenzoyl)amino]-4-phenylbenzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C20H14ClNO4/c21-14-7-9-16(18(23)11-14)19(24)22-17-10-13(6-8-15(17)20(25)26)12-4-2-1-3-5-12/h1-11,23H,(H,22,24)(H,25,26) |
| InChIKey | RENMYCUJXYANBN-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.79 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |