C19H13ClN2O3 — CID 87408033
2-[(6-chloropyridine-3-carbonyl)amino]-4-phenylbenzoic acid (PubChem CID 87408033) has the molecular formula C19H13ClN2O3 and a molecular weight of 352.78 g/mol. Its IUPAC name is 2-[(6-chloropyridine-3-carbonyl)amino]-4-phenylbenzoic acid.
| Compound Name | 2-[(6-chloropyridine-3-carbonyl)amino]-4-phenylbenzoic acid |
|---|---|
| PubChem CID | 87408033 |
| Molecular Formula | C19H13ClN2O3 |
| Molecular Weight | 352.78 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 2-[(6-chloropyridine-3-carbonyl)amino]-4-phenylbenzoic acid |
| SMILES | O=C(Nc1cc(-c2ccccc2)ccc1C(=O)O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H13ClN2O3/c20-17-9-7-14(11-21-17)18(23)22-16-10-13(6-8-15(16)19(24)25)12-4-2-1-3-5-12/h1-11H,(H,22,23)(H,24,25) |
| InChIKey | PDGLWHKDYZIUAG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|