C14H9ClN4OS — CID 27991303
6-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide (PubChem CID 27991303) has the molecular formula C14H9ClN4OS and a molecular weight of 316.77 g/mol. Its IUPAC name is 6-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide.
| Compound Name | 6-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 27991303 |
| Molecular Formula | C14H9ClN4OS |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 6-chloro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C14H9ClN4OS/c15-11-7-6-10(8-16-11)12(20)17-14-19-18-13(21-14)9-4-2-1-3-5-9/h1-8H,(H,17,19,20) |
| InChIKey | RPEZLFFWSLAHAG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|