C22H16N4O3S — CID 56548861
4-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]benzamide (PubChem CID 56548861) has the molecular formula C22H16N4O3S and a molecular weight of 416.46 g/mol. Its IUPAC name is 4-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]benzamide.
| Compound Name | 4-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]benzamide |
|---|---|
| PubChem CID | 56548861 |
| Molecular Formula | C22H16N4O3S |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | 4-[4-[(5-phenyl-1,3,4-thiadiazol-2-yl)carbamoyl]phenoxy]benzamide |
| SMILES | NC(=O)c1ccc(Oc2ccc(C(=O)Nc3nnc(-c4ccccc4)s3)cc2)cc1 |
| InChI | InChI=1S/C22H16N4O3S/c23-19(27)14-6-10-17(11-7-14)29-18-12-8-15(9-13-18)20(28)24-22-26-25-21(30-22)16-4-2-1-3-5-16/h1-13H,(H2,23,27)(H,24,26,28) |
| InChIKey | ZQTRMKTUFJYMHG-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |