C15H9F2N3OS — CID 27991331
3,4-difluoro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 27991331) has the molecular formula C15H9F2N3OS and a molecular weight of 317.32 g/mol. Its IUPAC name is 3,4-difluoro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 3,4-difluoro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 27991331 |
| Molecular Formula | C15H9F2N3OS |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.04 |
| IUPAC Name | 3,4-difluoro-N-(5-phenyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2)s1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9F2N3OS/c16-11-7-6-10(8-12(11)17)13(21)18-15-20-19-14(22-15)9-4-2-1-3-5-9/h1-8H,(H,18,20,21) |
| InChIKey | HKSSQTUMQGVMFI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |