C15H10FN3OS — CID 4222808
N-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 4222808) has the molecular formula C15H10FN3OS and a molecular weight of 299.33 g/mol. Its IUPAC name is N-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | N-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 4222808 |
| Molecular Formula | C15H10FN3OS |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.05 |
| IUPAC Name | N-[5-(2-fluorophenyl)-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2F)s1)c1ccccc1 |
| InChI | InChI=1S/C15H10FN3OS/c16-12-9-5-4-8-11(12)14-18-19-15(21-14)17-13(20)10-6-2-1-3-7-10/h1-9H,(H,17,19,20) |
| InChIKey | APVVKSBTXXDQAK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |