C14H7Cl3N4OS — CID 60576166
5,6-dichloro-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide (PubChem CID 60576166) has the molecular formula C14H7Cl3N4OS and a molecular weight of 385.66 g/mol. Its IUPAC name is 5,6-dichloro-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide.
| Compound Name | 5,6-dichloro-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 60576166 |
| Molecular Formula | C14H7Cl3N4OS |
| Molecular Weight | 385.66 g/mol |
| Exact Mass | 383.94 |
| IUPAC Name | 5,6-dichloro-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2Cl)s1)c1cnc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C14H7Cl3N4OS/c15-9-4-2-1-3-8(9)13-20-21-14(23-13)19-12(22)7-5-10(16)11(17)18-6-7/h1-6H,(H,19,21,22) |
| InChIKey | MRACXNSHRBGJFA-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|