C10H5Br3ClN3OS — CID 19256598
2,2,2-tribromo-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 19256598) has the molecular formula C10H5Br3ClN3OS and a molecular weight of 490.40 g/mol. Its IUPAC name is 2,2,2-tribromo-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2,2,2-tribromo-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 19256598 |
| Molecular Formula | C10H5Br3ClN3OS |
| Molecular Weight | 490.40 g/mol |
| Exact Mass | 486.74 |
| IUPAC Name | 2,2,2-tribromo-N-[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(Nc1nnc(-c2ccccc2Cl)s1)C(Br)(Br)Br |
| InChI | InChI=1S/C10H5Br3ClN3OS/c11-10(12,13)8(18)15-9-17-16-7(19-9)5-3-1-2-4-6(5)14/h1-4H,(H,15,17,18) |
| InChIKey | WCQSZRDTGSIAAT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.40 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|