C9H6ClN3S3 — CID 10827169
[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]carbamodithioic acid (PubChem CID 10827169) has the molecular formula C9H6ClN3S3 and a molecular weight of 287.82 g/mol. Its IUPAC name is [5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]carbamodithioic acid.
| Compound Name | [5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]carbamodithioic acid |
|---|---|
| PubChem CID | 10827169 |
| Molecular Formula | C9H6ClN3S3 |
| Molecular Weight | 287.82 g/mol |
| Exact Mass | 286.94 |
| IUPAC Name | [5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]carbamodithioic acid |
| SMILES | S=C(S)Nc1nnc(-c2ccccc2Cl)s1 |
| InChI | InChI=1S/C9H6ClN3S3/c10-6-4-2-1-3-5(6)7-12-13-8(16-7)11-9(14)15/h1-4H,(H2,11,13,14,15) |
| InChIKey | SBVCSHMBXWABDT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|