C13H9ClN6O2S — CID 56658048
2-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 56658048) has the molecular formula C13H9ClN6O2S and a molecular weight of 348.78 g/mol. Its IUPAC name is 2-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56658048 |
| Molecular Formula | C13H9ClN6O2S |
| Molecular Weight | 348.78 g/mol |
| Exact Mass | 348.02 |
| IUPAC Name | 2-[[5-(2-chlorophenyl)-1,3,4-thiadiazol-2-yl]amino]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(Nc2nnc(-c3ccccc3Cl)s2)nc1 |
| InChI | InChI=1S/C13H9ClN6O2S/c14-9-4-2-1-3-8(9)11-18-19-13(23-11)17-12-15-5-7(6-16-12)10(21)20-22/h1-6,22H,(H,20,21)(H,15,16,17,19) |
| InChIKey | WREGAHLAAIPNDM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 112.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.78 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|