C14H12N6O3S — CID 56661557
N-hydroxy-2-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]pyrimidine-5-carboxamide (PubChem CID 56661557) has the molecular formula C14H12N6O3S and a molecular weight of 344.36 g/mol. Its IUPAC name is N-hydroxy-2-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 56661557 |
| Molecular Formula | C14H12N6O3S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | N-hydroxy-2-[[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]amino]pyrimidine-5-carboxamide |
| SMILES | COc1ccc(-c2nnc(Nc3ncc(C(=O)NO)cn3)s2)cc1 |
| InChI | InChI=1S/C14H12N6O3S/c1-23-10-4-2-8(3-5-10)12-18-19-14(24-12)17-13-15-6-9(7-16-13)11(21)20-22/h2-7,22H,1H3,(H,20,21)(H,15,16,17,19) |
| InChIKey | ISJJBZJDLBJENE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 122.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|