C11H11N3O2S — CID 82424257
2-(4-methoxyphenyl)-1,3-thiazole-5-carbohydrazide (PubChem CID 82424257) has the molecular formula C11H11N3O2S and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1,3-thiazole-5-carbohydrazide.
| Compound Name | 2-(4-methoxyphenyl)-1,3-thiazole-5-carbohydrazide |
|---|---|
| PubChem CID | 82424257 |
| Molecular Formula | C11H11N3O2S |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 2-(4-methoxyphenyl)-1,3-thiazole-5-carbohydrazide |
| SMILES | COc1ccc(-c2ncc(C(=O)NN)s2)cc1 |
| InChI | InChI=1S/C11H11N3O2S/c1-16-8-4-2-7(3-5-8)11-13-6-9(17-11)10(15)14-12/h2-6H,12H2,1H3,(H,14,15) |
| InChIKey | GSPFZIUJGFELBF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|