C17H23N3O2S — CID 119667279
N-(1-aminohexan-2-yl)-2-(4-methoxyphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 119667279) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-(4-methoxyphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-(4-methoxyphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119667279 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-(4-methoxyphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCC(CN)NC(=O)c1cnc(-c2ccc(OC)cc2)s1 |
| InChI | InChI=1S/C17H23N3O2S/c1-3-4-5-13(10-18)20-16(21)15-11-19-17(23-15)12-6-8-14(22-2)9-7-12/h6-9,11,13H,3-5,10,18H2,1-2H3,(H,20,21) |
| InChIKey | FMWFRWBIVQKXRA-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |