C17H25ClN4O2 — CID 119667825
N-(1-aminohexan-2-yl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide;hydrochloride (PubChem CID 119667825) has the molecular formula C17H25ClN4O2 and a molecular weight of 352.87 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119667825 |
| Molecular Formula | C17H25ClN4O2 |
| Molecular Weight | 352.87 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | N-(1-aminohexan-2-yl)-1-(4-methoxyphenyl)pyrazole-3-carboxamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccn(-c2ccc(OC)cc2)n1.Cl |
| InChI | InChI=1S/C17H24N4O2.ClH/c1-3-4-5-13(12-18)19-17(22)16-10-11-21(20-16)14-6-8-15(23-2)9-7-14;/h6-11,13H,3-5,12,18H2,1-2H3,(H,19,22);1H |
| InChIKey | QIWQQDKSMPWCOF-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.87 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |