C15H20N4OS — CID 119665216
N-(1-aminohexan-2-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide (PubChem CID 119665216) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide.
| Compound Name | N-(1-aminohexan-2-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 119665216 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-(1-aminohexan-2-yl)-2-pyridin-4-yl-1,3-thiazole-5-carboxamide |
| SMILES | CCCCC(CN)NC(=O)c1cnc(-c2ccncc2)s1 |
| InChI | InChI=1S/C15H20N4OS/c1-2-3-4-12(9-16)19-14(20)13-10-18-15(21-13)11-5-7-17-8-6-11/h5-8,10,12H,2-4,9,16H2,1H3,(H,19,20) |
| InChIKey | DRADWNQJPTXVKK-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |