C13H20Cl2F3N3O — CID 119667500
N-(1-aminohexan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride (PubChem CID 119667500) has the molecular formula C13H20Cl2F3N3O and a molecular weight of 362.22 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119667500 |
| Molecular Formula | C13H20Cl2F3N3O |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | N-(1-aminohexan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide;dihydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc(C(F)(F)F)nc1.Cl.Cl |
| InChI | InChI=1S/C13H18F3N3O.2ClH/c1-2-3-4-10(7-17)19-12(20)9-5-6-11(18-8-9)13(14,15)16;;/h5-6,8,10H,2-4,7,17H2,1H3,(H,19,20);2*1H |
| InChIKey | DPMBWJKAWDKXRM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |