C14H21ClF2N2OS — CID 119666969
N-(1-aminohexan-2-yl)-4-(difluoromethylsulfanyl)benzamide;hydrochloride (PubChem CID 119666969) has the molecular formula C14H21ClF2N2OS and a molecular weight of 338.85 g/mol. Its IUPAC name is N-(1-aminohexan-2-yl)-4-(difluoromethylsulfanyl)benzamide;hydrochloride.
| Compound Name | N-(1-aminohexan-2-yl)-4-(difluoromethylsulfanyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119666969 |
| Molecular Formula | C14H21ClF2N2OS |
| Molecular Weight | 338.85 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | N-(1-aminohexan-2-yl)-4-(difluoromethylsulfanyl)benzamide;hydrochloride |
| SMILES | CCCCC(CN)NC(=O)c1ccc(SC(F)F)cc1.Cl |
| InChI | InChI=1S/C14H20F2N2OS.ClH/c1-2-3-4-11(9-17)18-13(19)10-5-7-12(8-6-10)20-14(15)16;/h5-8,11,14H,2-4,9,17H2,1H3,(H,18,19);1H |
| InChIKey | AXWWFGYHHDBLDY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.85 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |