C15H21F2NOS — CID 134055978
4-(difluoromethylsulfanyl)-N-(5-methylhexan-2-yl)benzamide (PubChem CID 134055978) has the molecular formula C15H21F2NOS and a molecular weight of 301.40 g/mol. Its IUPAC name is 4-(difluoromethylsulfanyl)-N-(5-methylhexan-2-yl)benzamide.
| Compound Name | 4-(difluoromethylsulfanyl)-N-(5-methylhexan-2-yl)benzamide |
|---|---|
| PubChem CID | 134055978 |
| Molecular Formula | C15H21F2NOS |
| Molecular Weight | 301.40 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 4-(difluoromethylsulfanyl)-N-(5-methylhexan-2-yl)benzamide |
| SMILES | CC(C)CCC(C)NC(=O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C15H21F2NOS/c1-10(2)4-5-11(3)18-14(19)12-6-8-13(9-7-12)20-15(16)17/h6-11,15H,4-5H2,1-3H3,(H,18,19) |
| InChIKey | ZCAOTUQMAYRYIB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.40 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |