C12H13F2NO3S — CID 119221139
3-[[4-(difluoromethylsulfanyl)benzoyl]amino]butanoic acid (PubChem CID 119221139) has the molecular formula C12H13F2NO3S and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-[[4-(difluoromethylsulfanyl)benzoyl]amino]butanoic acid.
| Compound Name | 3-[[4-(difluoromethylsulfanyl)benzoyl]amino]butanoic acid |
|---|---|
| PubChem CID | 119221139 |
| Molecular Formula | C12H13F2NO3S |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 3-[[4-(difluoromethylsulfanyl)benzoyl]amino]butanoic acid |
| SMILES | CC(CC(=O)O)NC(=O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C12H13F2NO3S/c1-7(6-10(16)17)15-11(18)8-2-4-9(5-3-8)19-12(13)14/h2-5,7,12H,6H2,1H3,(H,15,18)(H,16,17) |
| InChIKey | HZQAJPKMWWVUDH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |