C11H13F3N2O2 — CID 43424634
N-(1-hydroxybutan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide (PubChem CID 43424634) has the molecular formula C11H13F3N2O2 and a molecular weight of 262.23 g/mol. Its IUPAC name is N-(1-hydroxybutan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide.
| Compound Name | N-(1-hydroxybutan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 43424634 |
| Molecular Formula | C11H13F3N2O2 |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | N-(1-hydroxybutan-2-yl)-6-(trifluoromethyl)pyridine-3-carboxamide |
| SMILES | CCC(CO)NC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C11H13F3N2O2/c1-2-8(6-17)16-10(18)7-3-4-9(15-5-7)11(12,13)14/h3-5,8,17H,2,6H2,1H3,(H,16,18) |
| InChIKey | DXNBMPWVGYLYGC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |