C7H8Cl2F3N3O — CID 175168012
6-(trifluoromethyl)pyridine-3-carbohydrazide;dihydrochloride (PubChem CID 175168012) has the molecular formula C7H8Cl2F3N3O and a molecular weight of 278.06 g/mol. Its IUPAC name is 6-(trifluoromethyl)pyridine-3-carbohydrazide;dihydrochloride.
| Compound Name | 6-(trifluoromethyl)pyridine-3-carbohydrazide;dihydrochloride |
|---|---|
| PubChem CID | 175168012 |
| Molecular Formula | C7H8Cl2F3N3O |
| Molecular Weight | 278.06 g/mol |
| Exact Mass | 277.00 |
| IUPAC Name | 6-(trifluoromethyl)pyridine-3-carbohydrazide;dihydrochloride |
| SMILES | Cl.Cl.NNC(=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C7H6F3N3O.2ClH/c8-7(9,10)5-2-1-4(3-12-5)6(14)13-11;;/h1-3H,11H2,(H,13,14);2*1H |
| InChIKey | YJFBFECTDSKARY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.06 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|