C11H10F3N3O4 — CID 43638813
4-amino-4-oxo-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid (PubChem CID 43638813) has the molecular formula C11H10F3N3O4 and a molecular weight of 305.21 g/mol. Its IUPAC name is 4-amino-4-oxo-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid.
| Compound Name | 4-amino-4-oxo-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43638813 |
| Molecular Formula | C11H10F3N3O4 |
| Molecular Weight | 305.21 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | 4-amino-4-oxo-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1ccc(C(F)(F)F)nc1)C(=O)O |
| InChI | InChI=1S/C11H10F3N3O4/c12-11(13,14)7-2-1-5(4-16-7)9(19)17-6(10(20)21)3-8(15)18/h1-2,4,6H,3H2,(H2,15,18)(H,17,19)(H,20,21) |
| InChIKey | IWNYDSIRNYSJGS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.21 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |