C10H10ClN3O4 — CID 43240154
4-amino-2-[(6-chloropyridine-3-carbonyl)amino]-4-oxobutanoic acid (PubChem CID 43240154) has the molecular formula C10H10ClN3O4 and a molecular weight of 271.66 g/mol. Its IUPAC name is 4-amino-2-[(6-chloropyridine-3-carbonyl)amino]-4-oxobutanoic acid.
| Compound Name | 4-amino-2-[(6-chloropyridine-3-carbonyl)amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 43240154 |
| Molecular Formula | C10H10ClN3O4 |
| Molecular Weight | 271.66 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 4-amino-2-[(6-chloropyridine-3-carbonyl)amino]-4-oxobutanoic acid |
| SMILES | NC(=O)CC(NC(=O)c1ccc(Cl)nc1)C(=O)O |
| InChI | InChI=1S/C10H10ClN3O4/c11-7-2-1-5(4-13-7)9(16)14-6(10(17)18)3-8(12)15/h1-2,4,6H,3H2,(H2,12,15)(H,14,16)(H,17,18) |
| InChIKey | UVWGDYHTDAKJMG-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 122.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.66 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|