C13H17ClN2O3 — CID 51681559
methyl (2R)-2-[(6-chloropyridine-3-carbonyl)amino]-4-methylpentanoate (PubChem CID 51681559) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is methyl (2R)-2-[(6-chloropyridine-3-carbonyl)amino]-4-methylpentanoate.
| Compound Name | methyl (2R)-2-[(6-chloropyridine-3-carbonyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 51681559 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | methyl (2R)-2-[(6-chloropyridine-3-carbonyl)amino]-4-methylpentanoate |
| SMILES | COC(=O)[C@@H](CC(C)C)NC(=O)c1ccc(Cl)nc1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-8(2)6-10(13(18)19-3)16-12(17)9-4-5-11(14)15-7-9/h4-5,7-8,10H,6H2,1-3H3,(H,16,17)/t10-/m1/s1 |
| InChIKey | VMASXKWYESWHTG-SNVBAGLBSA-N |
| XLogP | 2.05 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|