C19H20Cl2N2O3 — CID 43049522
(6-chloro-3-pyridinyl)methyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate (PubChem CID 43049522) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is (6-chloro-3-pyridinyl)methyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate.
| Compound Name | (6-chloro-3-pyridinyl)methyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 43049522 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | (6-chloro-3-pyridinyl)methyl 2-[(4-chlorobenzoyl)amino]-4-methylpentanoate |
| SMILES | CC(C)CC(NC(=O)c1ccc(Cl)cc1)C(=O)OCc1ccc(Cl)nc1 |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-12(2)9-16(23-18(24)14-4-6-15(20)7-5-14)19(25)26-11-13-3-8-17(21)22-10-13/h3-8,10,12,16H,9,11H2,1-2H3,(H,23,24) |
| InChIKey | NQWNGORTVLRBEP-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|