C22H26ClN3O3 — CID 55575717
4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]amino]methyl]-N-methylbenzamide (PubChem CID 55575717) has the molecular formula C22H26ClN3O3 and a molecular weight of 415.92 g/mol. Its IUPAC name is 4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]amino]methyl]-N-methylbenzamide.
| Compound Name | 4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]amino]methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55575717 |
| Molecular Formula | C22H26ClN3O3 |
| Molecular Weight | 415.92 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | 4-[[[2-[(4-chlorobenzoyl)amino]-4-methylpentanoyl]amino]methyl]-N-methylbenzamide |
| SMILES | CNC(=O)c1ccc(CNC(=O)C(CC(C)C)NC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C22H26ClN3O3/c1-14(2)12-19(26-21(28)17-8-10-18(23)11-9-17)22(29)25-13-15-4-6-16(7-5-15)20(27)24-3/h4-11,14,19H,12-13H2,1-3H3,(H,24,27)(H,25,29)(H,26,28) |
| InChIKey | TZNLZYWSOGYIHW-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.92 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |